About 2,3-dimethylheptane-1,6-diamine
2,3-dimethylheptane-1,6-diamine (PubChem CID 23186430) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is 2,3-dimethylheptane-1,6-diamine.
Molecular Properties
| Compound Name | 2,3-dimethylheptane-1,6-diamine |
| PubChem CID | 23186430 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 2,3-dimethylheptane-1,6-diamine |
| SMILES | CC(N)CCC(C)C(C)CN |
| InChI | InChI=1S/C9H22N2/c1-7(8(2)6-10)4-5-9(3)11/h7-9H,4-6,10-11H2,1-3H3 |
| InChIKey | JCVMHHBBELZJEC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethylheptane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylheptane-1,6-diamine?
The IUPAC name of 2,3-dimethylheptane-1,6-diamine (CID 23186430) is 2,3-dimethylheptane-1,6-diamine.
What is the SMILES notation for 2,3-dimethylheptane-1,6-diamine?
The canonical SMILES for 2,3-dimethylheptane-1,6-diamine is CC(N)CCC(C)C(C)CN.
What is the InChIKey of 2,3-dimethylheptane-1,6-diamine?
The InChIKey is JCVMHHBBELZJEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2/c1-7(8(2)6-10)4-5-9(3)11/h7-9H,4-6,10-11H2,1-3H3.
What are the key properties of 2,3-dimethylheptane-1,6-diamine?
2,3-dimethylheptane-1,6-diamine has a molecular weight of 158.29 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylheptane-1,6-diamine is sourced from PubChem (CID 23186430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).