C19H7Cl2I3N2O6 — CID 23186469
5-[[3-(1,3-dioxoisoindol-5-yl)-3-oxopropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride (PubChem CID 23186469) has the molecular formula C19H7Cl2I3N2O6 and a molecular weight of 810.89 g/mol. Its IUPAC name is 5-[[3-(1,3-dioxoisoindol-5-yl)-3-oxopropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride.
| Compound Name | 5-[[3-(1,3-dioxoisoindol-5-yl)-3-oxopropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 23186469 |
| Molecular Formula | C19H7Cl2I3N2O6 |
| Molecular Weight | 810.89 g/mol |
| Exact Mass | 809.68 |
| IUPAC Name | 5-[[3-(1,3-dioxoisoindol-5-yl)-3-oxopropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
| SMILES | O=C(CC(=O)c1ccc2c(c1)C(=O)NC2=O)Nc1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C19H7Cl2I3N2O6/c20-16(29)10-12(22)11(17(21)30)14(24)15(13(10)23)25-9(28)4-8(27)5-1-2-6-7(3-5)19(32)26-18(6)31/h1-3H,4H2,(H,25,28)(H,26,31,32) |
| InChIKey | ODDQCOMBRJSXCP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|