About bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol
bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol (PubChem CID 23187370) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol.
Molecular Properties
| Compound Name | bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol |
| PubChem CID | 23187370 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol |
| SMILES | OCC1CO1.c1cc2ccc1cc2 |
| InChI | InChI=1S/C8H6.C3H6O2/c1-2-8-5-3-7(1)4-6-8;4-1-3-2-5-3/h1-6H;3-4H,1-2H2 |
| InChIKey | QEPWTXHHGNPDEZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol?
The IUPAC name of bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol (CID 23187370) is bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol.
What is the SMILES notation for bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol?
The canonical SMILES for bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol is OCC1CO1.c1cc2ccc1cc2.
What is the InChIKey of bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol?
The InChIKey is QEPWTXHHGNPDEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6.C3H6O2/c1-2-8-5-3-7(1)4-6-8;4-1-3-2-5-3/h1-6H;3-4H,1-2H2.
What are the key properties of bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol?
bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol has a molecular weight of 176.22 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.2]octa-1,3,5,7-tetraene;oxiran-2-ylmethanol is sourced from PubChem (CID 23187370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).