About thieno[2,3-d]pyrimidin-2-ylmethanamine
thieno[2,3-d]pyrimidin-2-ylmethanamine (PubChem CID 23187434) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is thieno[2,3-d]pyrimidin-2-ylmethanamine.
Molecular Properties
| Compound Name | thieno[2,3-d]pyrimidin-2-ylmethanamine |
| PubChem CID | 23187434 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | thieno[2,3-d]pyrimidin-2-ylmethanamine |
| SMILES | NCc1ncc2ccsc2n1 |
| InChI | InChI=1S/C7H7N3S/c8-3-6-9-4-5-1-2-11-7(5)10-6/h1-2,4H,3,8H2 |
| InChIKey | YCDSNPDPOWHSDI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[2,3-d]pyrimidin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-d]pyrimidin-2-ylmethanamine?
The IUPAC name of thieno[2,3-d]pyrimidin-2-ylmethanamine (CID 23187434) is thieno[2,3-d]pyrimidin-2-ylmethanamine.
What is the SMILES notation for thieno[2,3-d]pyrimidin-2-ylmethanamine?
The canonical SMILES for thieno[2,3-d]pyrimidin-2-ylmethanamine is NCc1ncc2ccsc2n1.
What is the InChIKey of thieno[2,3-d]pyrimidin-2-ylmethanamine?
The InChIKey is YCDSNPDPOWHSDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c8-3-6-9-4-5-1-2-11-7(5)10-6/h1-2,4H,3,8H2.
What are the key properties of thieno[2,3-d]pyrimidin-2-ylmethanamine?
thieno[2,3-d]pyrimidin-2-ylmethanamine has a molecular weight of 165.22 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-d]pyrimidin-2-ylmethanamine is sourced from PubChem (CID 23187434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).