About 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid
1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid (PubChem CID 23188313) has the molecular formula C20H17F2N3O4
and a molecular weight of 401.37 g/mol. Its IUPAC name is 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid |
| PubChem CID | 23188313 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1ccc(-n2cc(C(=O)O)c(=O)c3cc(F)c(C4CNCCO4)c(F)c32)cc1 |
| InChI | InChI=1S/C20H17F2N3O4/c21-14-7-12-18(17(22)16(14)15-8-24-5-6-29-15)25(9-13(19(12)26)20(27)28)11-3-1-10(23)2-4-11/h1-4,7,9,15,24H,5-6,8,23H2,(H,27,28) |
| InChIKey | YOKWWKQJENZLRX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid?
The IUPAC name of 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid (CID 23188313) is 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid.
What is the SMILES notation for 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid?
The canonical SMILES for 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid is Nc1ccc(-n2cc(C(=O)O)c(=O)c3cc(F)c(C4CNCCO4)c(F)c32)cc1.
What is the InChIKey of 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid?
The InChIKey is YOKWWKQJENZLRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N3O4/c21-14-7-12-18(17(22)16(14)15-8-24-5-6-29-15)25(9-13(19(12)26)20(27)28)11-3-1-10(23)2-4-11/h1-4,7,9,15,24H,5-6,8,23H2,(H,27,28).
What are the key properties of 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid?
1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid has a molecular weight of 401.37 g/mol, XLogP of 2.21, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminophenyl)-6,8-difluoro-7-morpholin-2-yl-4-oxoquinoline-3-carboxylic acid is sourced from PubChem (CID 23188313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).