C8H6Cl6O6 — CID 2318862
[(2R,3S)-3-(2,2,2-trichloroacetyl)oxy-1,4-dioxan-2-yl] 2,2,2-trichloroacetate (PubChem CID 2318862) has the molecular formula C8H6Cl6O6 and a molecular weight of 410.85 g/mol. Its IUPAC name is [(2R,3S)-3-(2,2,2-trichloroacetyl)oxy-1,4-dioxan-2-yl] 2,2,2-trichloroacetate.
| Compound Name | [(2R,3S)-3-(2,2,2-trichloroacetyl)oxy-1,4-dioxan-2-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 2318862 |
| Molecular Formula | C8H6Cl6O6 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 407.83 |
| IUPAC Name | [(2R,3S)-3-(2,2,2-trichloroacetyl)oxy-1,4-dioxan-2-yl] 2,2,2-trichloroacetate |
| SMILES | O=C(O[C@H]1OCCO[C@H]1OC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H6Cl6O6/c9-7(10,11)5(15)19-3-4(18-2-1-17-3)20-6(16)8(12,13)14/h3-4H,1-2H2/t3-,4+ |
| InChIKey | NURLQBNYRHCCNY-ZXZARUISSA-N |
| XLogP | 2.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|