About 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione
1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione (PubChem CID 23189083) has the molecular formula C20H21NO6
and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione |
| PubChem CID | 23189083 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2N(CC(O)CO)CC(O)CO |
| InChI | InChI=1S/C20H21NO6/c22-10-12(24)8-21(9-13(25)11-23)17-7-3-6-16-18(17)20(27)15-5-2-1-4-14(15)19(16)26/h1-7,12-13,22-25H,8-11H2 |
| InChIKey | XXOJYPILQZQPPO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione?
The IUPAC name of 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione (CID 23189083) is 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione.
What is the SMILES notation for 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione?
The canonical SMILES for 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione is O=C1c2ccccc2C(=O)c2c1cccc2N(CC(O)CO)CC(O)CO.
What is the InChIKey of 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione?
The InChIKey is XXOJYPILQZQPPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO6/c22-10-12(24)8-21(9-13(25)11-23)17-7-3-6-16-18(17)20(27)15-5-2-1-4-14(15)19(16)26/h1-7,12-13,22-25H,8-11H2.
What are the key properties of 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione?
1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione has a molecular weight of 371.39 g/mol, XLogP of -0.03, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2,3-dihydroxypropyl)amino]anthracene-9,10-dione is sourced from PubChem (CID 23189083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).