About N-(5-chloro-1,3-thiazolidin-5-yl)propanamide
N-(5-chloro-1,3-thiazolidin-5-yl)propanamide (PubChem CID 23189886) has the molecular formula C6H11ClN2OS
and a molecular weight of 194.69 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazolidin-5-yl)propanamide.
Molecular Properties
| Compound Name | N-(5-chloro-1,3-thiazolidin-5-yl)propanamide |
| PubChem CID | 23189886 |
| Molecular Formula | C6H11ClN2OS |
| Molecular Weight | 194.69 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | N-(5-chloro-1,3-thiazolidin-5-yl)propanamide |
| SMILES | CCC(=O)NC1(Cl)CNCS1 |
| InChI | InChI=1S/C6H11ClN2OS/c1-2-5(10)9-6(7)3-8-4-11-6/h8H,2-4H2,1H3,(H,9,10) |
| InChIKey | RWEKZCZDNKQBTO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.69 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloro-1,3-thiazolidin-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-1,3-thiazolidin-5-yl)propanamide?
The IUPAC name of N-(5-chloro-1,3-thiazolidin-5-yl)propanamide (CID 23189886) is N-(5-chloro-1,3-thiazolidin-5-yl)propanamide.
What is the SMILES notation for N-(5-chloro-1,3-thiazolidin-5-yl)propanamide?
The canonical SMILES for N-(5-chloro-1,3-thiazolidin-5-yl)propanamide is CCC(=O)NC1(Cl)CNCS1.
What is the InChIKey of N-(5-chloro-1,3-thiazolidin-5-yl)propanamide?
The InChIKey is RWEKZCZDNKQBTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClN2OS/c1-2-5(10)9-6(7)3-8-4-11-6/h8H,2-4H2,1H3,(H,9,10).
What are the key properties of N-(5-chloro-1,3-thiazolidin-5-yl)propanamide?
N-(5-chloro-1,3-thiazolidin-5-yl)propanamide has a molecular weight of 194.69 g/mol, XLogP of 0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-1,3-thiazolidin-5-yl)propanamide is sourced from PubChem (CID 23189886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).