About 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid
2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid (PubChem CID 23189890) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid.
Molecular Properties
| Compound Name | 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid |
| PubChem CID | 23189890 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid |
| SMILES | CC1(C)C2CCC1(C)C(C(SC#N)C(=O)O)C2 |
| InChI | InChI=1S/C13H19NO2S/c1-12(2)8-4-5-13(12,3)9(6-8)10(11(15)16)17-7-14/h8-10H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | UTPUEOHQSXIUEI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid?
The IUPAC name of 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid (CID 23189890) is 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid.
What is the SMILES notation for 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid?
The canonical SMILES for 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid is CC1(C)C2CCC1(C)C(C(SC#N)C(=O)O)C2.
What is the InChIKey of 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid?
The InChIKey is UTPUEOHQSXIUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-12(2)8-4-5-13(12,3)9(6-8)10(11(15)16)17-7-14/h8-10H,4-6H2,1-3H3,(H,15,16).
What are the key properties of 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid?
2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid has a molecular weight of 253.37 g/mol, XLogP of 3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiocyanato-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetic acid is sourced from PubChem (CID 23189890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).