About ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate
ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate (PubChem CID 23190031) has the molecular formula C10H12N2O2S2
and a molecular weight of 256.35 g/mol. Its IUPAC name is ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate |
| PubChem CID | 23190031 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(SCC)nc2sccn12 |
| InChI | InChI=1S/C10H12N2O2S2/c1-3-14-9(13)7-8(15-4-2)11-10-12(7)5-6-16-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | YSYJDWVEABRNDJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
The IUPAC name of ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate (CID 23190031) is ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate.
What is the SMILES notation for ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
The canonical SMILES for ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate is CCOC(=O)c1c(SCC)nc2sccn12.
What is the InChIKey of ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
The InChIKey is YSYJDWVEABRNDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S2/c1-3-14-9(13)7-8(15-4-2)11-10-12(7)5-6-16-10/h5-6H,3-4H2,1-2H3.
What are the key properties of ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate has a molecular weight of 256.35 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole-5-carboxylate is sourced from PubChem (CID 23190031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).