About 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide
2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide (PubChem CID 23190089) has the molecular formula C23H23FN2O3
and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide |
| PubChem CID | 23190089 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide |
| SMILES | COc1ccc(-c2nc(-c3ccc(F)cc3)ccc2C(=O)NC(C)C)cc1OC |
| InChI | InChI=1S/C23H23FN2O3/c1-14(2)25-23(27)18-10-11-19(15-5-8-17(24)9-6-15)26-22(18)16-7-12-20(28-3)21(13-16)29-4/h5-14H,1-4H3,(H,25,27) |
| InChIKey | DIOXVUBKXDBBLU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide (CID 23190089) is 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide is COc1ccc(-c2nc(-c3ccc(F)cc3)ccc2C(=O)NC(C)C)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide?
The InChIKey is DIOXVUBKXDBBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN2O3/c1-14(2)25-23(27)18-10-11-19(15-5-8-17(24)9-6-15)26-22(18)16-7-12-20(28-3)21(13-16)29-4/h5-14H,1-4H3,(H,25,27).
What are the key properties of 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide?
2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide has a molecular weight of 394.45 g/mol, XLogP of 4.71, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-6-(4-fluorophenyl)-N-propan-2-ylpyridine-3-carboxamide is sourced from PubChem (CID 23190089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).