About 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol
1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol (PubChem CID 23190298) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol |
| PubChem CID | 23190298 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol |
| SMILES | CC1(C)CCCNC1CN1CCC(O)C1 |
| InChI | InChI=1S/C12H24N2O/c1-12(2)5-3-6-13-11(12)9-14-7-4-10(15)8-14/h10-11,13,15H,3-9H2,1-2H3 |
| InChIKey | IIRGTXQJURRSNQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol?
The IUPAC name of 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol (CID 23190298) is 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol?
The canonical SMILES for 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol is CC1(C)CCCNC1CN1CCC(O)C1.
What is the InChIKey of 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol?
The InChIKey is IIRGTXQJURRSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-12(2)5-3-6-13-11(12)9-14-7-4-10(15)8-14/h10-11,13,15H,3-9H2,1-2H3.
What are the key properties of 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol?
1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol has a molecular weight of 212.34 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,3-dimethylpiperidin-2-yl)methyl]pyrrolidin-3-ol is sourced from PubChem (CID 23190298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).