About 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine
2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine (PubChem CID 23190305) has the molecular formula C12H23FN2
and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine |
| PubChem CID | 23190305 |
| Molecular Formula | C12H23FN2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine |
| SMILES | CC1(C)CCCNC1CN1CCC(F)C1 |
| InChI | InChI=1S/C12H23FN2/c1-12(2)5-3-6-14-11(12)9-15-7-4-10(13)8-15/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | VWPSAWFREMPTNC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine?
The IUPAC name of 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine (CID 23190305) is 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine.
What is the SMILES notation for 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine?
The canonical SMILES for 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine is CC1(C)CCCNC1CN1CCC(F)C1.
What is the InChIKey of 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine?
The InChIKey is VWPSAWFREMPTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23FN2/c1-12(2)5-3-6-14-11(12)9-15-7-4-10(13)8-15/h10-11,14H,3-9H2,1-2H3.
What are the key properties of 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine?
2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine has a molecular weight of 214.33 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-fluoropyrrolidin-1-yl)methyl]-3,3-dimethylpiperidine is sourced from PubChem (CID 23190305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).