C11H10F12 — CID 23190443
3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-3-propan-2-yloct-1-ene (PubChem CID 23190443) has the molecular formula C11H10F12 and a molecular weight of 370.18 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-3-propan-2-yloct-1-ene.
| Compound Name | 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-3-propan-2-yloct-1-ene |
|---|---|
| PubChem CID | 23190443 |
| Molecular Formula | C11H10F12 |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-3-propan-2-yloct-1-ene |
| SMILES | C=CC(F)(C(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F12/c1-4-6(12,5(2)3)7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)23/h4-5H,1H2,2-3H3 |
| InChIKey | ZGABEARQYUXBNQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|