C21H18F3N — CID 23190501
3-[4-(4-butylphenyl)phenyl]-2,5,6-trifluoropyridine (PubChem CID 23190501) has the molecular formula C21H18F3N and a molecular weight of 341.38 g/mol. Its IUPAC name is 3-[4-(4-butylphenyl)phenyl]-2,5,6-trifluoropyridine.
| Compound Name | 3-[4-(4-butylphenyl)phenyl]-2,5,6-trifluoropyridine |
|---|---|
| PubChem CID | 23190501 |
| Molecular Formula | C21H18F3N |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[4-(4-butylphenyl)phenyl]-2,5,6-trifluoropyridine |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(F)c(F)nc3F)cc2)cc1 |
| InChI | InChI=1S/C21H18F3N/c1-2-3-4-14-5-7-15(8-6-14)16-9-11-17(12-10-16)18-13-19(22)21(24)25-20(18)23/h5-13H,2-4H2,1H3 |
| InChIKey | ITIWORINNCUYTN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|