C16H17Cl2N — CID 23190641
2,3-dichloro-5-(4-pentylphenyl)pyridine (PubChem CID 23190641) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 2,3-dichloro-5-(4-pentylphenyl)pyridine.
| Compound Name | 2,3-dichloro-5-(4-pentylphenyl)pyridine |
|---|---|
| PubChem CID | 23190641 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2,3-dichloro-5-(4-pentylphenyl)pyridine |
| SMILES | CCCCCc1ccc(-c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H17Cl2N/c1-2-3-4-5-12-6-8-13(9-7-12)14-10-15(17)16(18)19-11-14/h6-11H,2-5H2,1H3 |
| InChIKey | UNUFGTWWOKQCMP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|