C27H21BrN3+ — CID 2319091
10-(4-bromophenyl)-9-(4-methylphenyl)-7,8-dihydroimidazo[1,2-a][1,10]phenanthrolin-12-ium (PubChem CID 2319091) has the molecular formula C27H21BrN3+ and a molecular weight of 467.39 g/mol. Its IUPAC name is 10-(4-bromophenyl)-9-(4-methylphenyl)-7,8-dihydroimidazo[1,2-a][1,10]phenanthrolin-12-ium.
| Compound Name | 10-(4-bromophenyl)-9-(4-methylphenyl)-7,8-dihydroimidazo[1,2-a][1,10]phenanthrolin-12-ium |
|---|---|
| PubChem CID | 2319091 |
| Molecular Formula | C27H21BrN3+ |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 10-(4-bromophenyl)-9-(4-methylphenyl)-7,8-dihydroimidazo[1,2-a][1,10]phenanthrolin-12-ium |
| SMILES | Cc1ccc(-n2c(-c3ccc(Br)cc3)c[n+]3c2CCc2ccc4cccnc4c2-3)cc1 |
| InChI | InChI=1S/C27H21BrN3/c1-18-4-13-23(14-5-18)31-24(19-8-11-22(28)12-9-19)17-30-25(31)15-10-21-7-6-20-3-2-16-29-26(20)27(21)30/h2-9,11-14,16-17H,10,15H2,1H3/q+1 |
| InChIKey | XZGBHFABTFSDLU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|