C9H5F3N2O2S2 — CID 2319094
6,7,8-trifluoro-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole 2,2-dioxide (PubChem CID 2319094) has the molecular formula C9H5F3N2O2S2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 6,7,8-trifluoro-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole 2,2-dioxide.
| Compound Name | 6,7,8-trifluoro-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole 2,2-dioxide |
|---|---|
| PubChem CID | 2319094 |
| Molecular Formula | C9H5F3N2O2S2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 6,7,8-trifluoro-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole 2,2-dioxide |
| SMILES | O=S1(=O)CCN2C(=N1)Sc1cc(F)c(F)c(F)c12 |
| InChI | InChI=1S/C9H5F3N2O2S2/c10-4-3-5-8(7(12)6(4)11)14-1-2-18(15,16)13-9(14)17-5/h3H,1-2H2 |
| InChIKey | BLTIUCGQHMCMCN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|