About 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate
5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate (PubChem CID 23191712) has the molecular formula C12H15N3O3S2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate.
Molecular Properties
| Compound Name | 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate |
| PubChem CID | 23191712 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate |
| SMILES | COc1cc(C)ccc1OC(C)=O.Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C10H12O3.C2H3N3S2/c1-7-4-5-9(13-8(2)11)10(6-7)12-3;3-1-4-5-2(6)7-1/h4-6H,1-3H3;(H2,3,4)(H,5,6) |
| InChIKey | ODJIOFADUUTXNR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate?
The IUPAC name of 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate (CID 23191712) is 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate.
What is the SMILES notation for 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate?
The canonical SMILES for 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate is COc1cc(C)ccc1OC(C)=O.Nc1n[nH]c(=S)s1.
What is the InChIKey of 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate?
The InChIKey is ODJIOFADUUTXNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.C2H3N3S2/c1-7-4-5-9(13-8(2)11)10(6-7)12-3;3-1-4-5-2(6)7-1/h4-6H,1-3H3;(H2,3,4)(H,5,6).
What are the key properties of 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate?
5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate has a molecular weight of 313.40 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3H-1,3,4-thiadiazole-2-thione;(2-methoxy-4-methylphenyl) acetate is sourced from PubChem (CID 23191712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).