C10F17N — CID 23192226
2,3,4,4,4a,5,5,6,6,7,7,8,8,8a-tetradecafluoro-1-(trifluoromethyl)quinoline (PubChem CID 23192226) has the molecular formula C10F17N and a molecular weight of 457.08 g/mol. Its IUPAC name is 2,3,4,4,4a,5,5,6,6,7,7,8,8,8a-tetradecafluoro-1-(trifluoromethyl)quinoline.
| Compound Name | 2,3,4,4,4a,5,5,6,6,7,7,8,8,8a-tetradecafluoro-1-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 23192226 |
| Molecular Formula | C10F17N |
| Molecular Weight | 457.08 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | 2,3,4,4,4a,5,5,6,6,7,7,8,8,8a-tetradecafluoro-1-(trifluoromethyl)quinoline |
| SMILES | FC1=C(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)N1C(F)(F)F |
| InChI | InChI=1S/C10F17N/c11-1-2(12)28(10(25,26)27)9(24)4(15,3(1,13)14)5(16,17)6(18,19)7(20,21)8(9,22)23 |
| InChIKey | JNFHISYTQDJVLW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.08 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|