C14F22 — CID 23192227
1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,8a,9,9,10,10,10a-docosafluorophenanthrene (PubChem CID 23192227) has the molecular formula C14F22 and a molecular weight of 586.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,8a,9,9,10,10,10a-docosafluorophenanthrene.
| Compound Name | 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,8a,9,9,10,10,10a-docosafluorophenanthrene |
|---|---|
| PubChem CID | 23192227 |
| Molecular Formula | C14F22 |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.96 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,8,8a,9,9,10,10,10a-docosafluorophenanthrene |
| SMILES | FC1=C(F)C2(F)C(F)(F)C(F)(F)C3(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C3(F)C2(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14F22/c15-1-2(16)4(18,19)9(25,26)5(20)3(1,17)8(23,24)11(29,30)7(22)6(5,21)10(27,28)13(33,34)14(35,36)12(7,31)32 |
| InChIKey | XDPVDBFKNYGUCN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|