C17H12BrN5O3 — CID 2319259
3-[3-(4-bromophenyl)-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrazol-1-yl]propanenitrile (PubChem CID 2319259) has the molecular formula C17H12BrN5O3 and a molecular weight of 414.22 g/mol. Its IUPAC name is 3-[3-(4-bromophenyl)-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrazol-1-yl]propanenitrile.
| Compound Name | 3-[3-(4-bromophenyl)-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 2319259 |
| Molecular Formula | C17H12BrN5O3 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 3-[3-(4-bromophenyl)-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrazol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(C=C2C(=O)NC(=O)NC2=O)c(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C17H12BrN5O3/c18-12-4-2-10(3-5-12)14-11(9-23(22-14)7-1-6-19)8-13-15(24)20-17(26)21-16(13)25/h2-5,8-9H,1,7H2,(H2,20,21,24,25,26) |
| InChIKey | GFQFQWMAJAZTCE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|