About 5-phenylpentane-1,3,4-triol
5-phenylpentane-1,3,4-triol (PubChem CID 23192783) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-phenylpentane-1,3,4-triol.
Molecular Properties
| Compound Name | 5-phenylpentane-1,3,4-triol |
| PubChem CID | 23192783 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 5-phenylpentane-1,3,4-triol |
| SMILES | OCCC(O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C11H16O3/c12-7-6-10(13)11(14)8-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2 |
| InChIKey | NBMFDNRJHLWVHY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenylpentane-1,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpentane-1,3,4-triol?
The IUPAC name of 5-phenylpentane-1,3,4-triol (CID 23192783) is 5-phenylpentane-1,3,4-triol.
What is the SMILES notation for 5-phenylpentane-1,3,4-triol?
The canonical SMILES for 5-phenylpentane-1,3,4-triol is OCCC(O)C(O)Cc1ccccc1.
What is the InChIKey of 5-phenylpentane-1,3,4-triol?
The InChIKey is NBMFDNRJHLWVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c12-7-6-10(13)11(14)8-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2.
What are the key properties of 5-phenylpentane-1,3,4-triol?
5-phenylpentane-1,3,4-triol has a molecular weight of 196.25 g/mol, XLogP of 0.33, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpentane-1,3,4-triol is sourced from PubChem (CID 23192783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).