About N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide
N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide (PubChem CID 23192794) has the molecular formula C18H21IN2O
and a molecular weight of 408.28 g/mol. Its IUPAC name is N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide.
Molecular Properties
| Compound Name | N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide |
| PubChem CID | 23192794 |
| Molecular Formula | C18H21IN2O |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide |
| SMILES | CC(C)(C)N(Cc1ccccc1I)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21IN2O/c1-18(2,3)21(13-15-11-7-8-12-16(15)19)20-17(22)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3,(H,20,22) |
| InChIKey | WGOBNTDKTUEQTF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide?
The IUPAC name of N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide (CID 23192794) is N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide.
What is the SMILES notation for N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide?
The canonical SMILES for N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide is CC(C)(C)N(Cc1ccccc1I)NC(=O)c1ccccc1.
What is the InChIKey of N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide?
The InChIKey is WGOBNTDKTUEQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21IN2O/c1-18(2,3)21(13-15-11-7-8-12-16(15)19)20-17(22)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3,(H,20,22).
What are the key properties of N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide?
N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide has a molecular weight of 408.28 g/mol, XLogP of 4.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-N'-[(2-iodophenyl)methyl]benzohydrazide is sourced from PubChem (CID 23192794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).