About (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate
(1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate (PubChem CID 23193014) has the molecular formula C18H26F2O2
and a molecular weight of 312.40 g/mol. Its IUPAC name is (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate |
| PubChem CID | 23193014 |
| Molecular Formula | C18H26F2O2 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)OC2(F)C=CC=CC2F)CC1 |
| InChI | InChI=1S/C18H26F2O2/c1-2-3-4-7-14-9-11-15(12-10-14)17(21)22-18(20)13-6-5-8-16(18)19/h5-6,8,13-16H,2-4,7,9-12H2,1H3 |
| InChIKey | AMFYMLAOQSZZBK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate?
The IUPAC name of (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate (CID 23193014) is (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate.
What is the SMILES notation for (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate?
The canonical SMILES for (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate is CCCCCC1CCC(C(=O)OC2(F)C=CC=CC2F)CC1.
What is the InChIKey of (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate?
The InChIKey is AMFYMLAOQSZZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F2O2/c1-2-3-4-7-14-9-11-15(12-10-14)17(21)22-18(20)13-6-5-8-16(18)19/h5-6,8,13-16H,2-4,7,9-12H2,1H3.
What are the key properties of (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate?
(1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate has a molecular weight of 312.40 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-difluorocyclohexa-2,4-dien-1-yl) 4-pentylcyclohexane-1-carboxylate is sourced from PubChem (CID 23193014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).