C19H24N3+ — CID 2319315
2-[(4aS)-7-(azepan-1-ium-1-yl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile (PubChem CID 2319315) has the molecular formula C19H24N3+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[(4aS)-7-(azepan-1-ium-1-yl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile.
| Compound Name | 2-[(4aS)-7-(azepan-1-ium-1-yl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 2319315 |
| Molecular Formula | C19H24N3+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-[(4aS)-7-(azepan-1-ium-1-yl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C=C2C=C([NH+]3CCCCCC3)CC[C@@H]2CC1 |
| InChI | InChI=1S/C19H23N3/c20-13-18(14-21)16-6-5-15-7-8-19(12-17(15)11-16)22-9-3-1-2-4-10-22/h11-12,15H,1-10H2/p+1/t15-/m0/s1 |
| InChIKey | BGGDEFKPEMIBMY-HNNXBMFYSA-O |
| XLogP | 2.80 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|