C12H13N3O3 — CID 23193665
4-hydroxy-8-methyl-1,7,9,10-tetrahydropyrido[4,3-f]quinoxaline-2,3-dione (PubChem CID 23193665) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-hydroxy-8-methyl-1,7,9,10-tetrahydropyrido[4,3-f]quinoxaline-2,3-dione.
| Compound Name | 4-hydroxy-8-methyl-1,7,9,10-tetrahydropyrido[4,3-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 23193665 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-hydroxy-8-methyl-1,7,9,10-tetrahydropyrido[4,3-f]quinoxaline-2,3-dione |
| SMILES | CN1CCc2c(ccc3c2[nH]c(=O)c(=O)n3O)C1 |
| InChI | InChI=1S/C12H13N3O3/c1-14-5-4-8-7(6-14)2-3-9-10(8)13-11(16)12(17)15(9)18/h2-3,18H,4-6H2,1H3,(H,13,16) |
| InChIKey | BSPCWYBPQXTPHJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|