C13H15BrClN3O2 — CID 23193691
6-bromo-8-ethyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione;hydrochloride (PubChem CID 23193691) has the molecular formula C13H15BrClN3O2 and a molecular weight of 360.64 g/mol. Its IUPAC name is 6-bromo-8-ethyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione;hydrochloride.
| Compound Name | 6-bromo-8-ethyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 23193691 |
| Molecular Formula | C13H15BrClN3O2 |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 6-bromo-8-ethyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione;hydrochloride |
| SMILES | CCN1CCc2c(c(Br)cc3[nH]c(=O)c(=O)[nH]c23)C1.Cl |
| InChI | InChI=1S/C13H14BrN3O2.ClH/c1-2-17-4-3-7-8(6-17)9(14)5-10-11(7)16-13(19)12(18)15-10;/h5H,2-4,6H2,1H3,(H,15,18)(H,16,19);1H |
| InChIKey | GIBLNOCDCOEOKE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|