C23H29NO2 — CID 23195096
[amino-phenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl] acetate (PubChem CID 23195096) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is [amino-phenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl] acetate.
| Compound Name | [amino-phenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl] acetate |
|---|---|
| PubChem CID | 23195096 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | [amino-phenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl] acetate |
| SMILES | CC(=O)OC(N)(c1ccccc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H29NO2/c1-16(25)26-23(24,17-9-7-6-8-10-17)18-11-12-19-20(15-18)22(4,5)14-13-21(19,2)3/h6-12,15H,13-14,24H2,1-5H3 |
| InChIKey | AITAXMWNIAWROH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|