About 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine
2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine (PubChem CID 23195791) has the molecular formula C18H18F3NO2S
and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine.
Molecular Properties
| Compound Name | 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine |
| PubChem CID | 23195791 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine |
| SMILES | COC1(c2ccccn2)CC(C)(C)Oc2ccc(SC(F)(F)F)cc21 |
| InChI | InChI=1S/C18H18F3NO2S/c1-16(2)11-17(23-3,15-6-4-5-9-22-15)13-10-12(25-18(19,20)21)7-8-14(13)24-16/h4-10H,11H2,1-3H3 |
| InChIKey | HDQVMXRBYHOQPV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine?
The IUPAC name of 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine (CID 23195791) is 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine.
What is the SMILES notation for 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine?
The canonical SMILES for 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine is COC1(c2ccccn2)CC(C)(C)Oc2ccc(SC(F)(F)F)cc21.
What is the InChIKey of 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine?
The InChIKey is HDQVMXRBYHOQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3NO2S/c1-16(2)11-17(23-3,15-6-4-5-9-22-15)13-10-12(25-18(19,20)21)7-8-14(13)24-16/h4-10H,11H2,1-3H3.
What are the key properties of 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine?
2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine has a molecular weight of 369.41 g/mol, XLogP of 5.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanyl)-3H-chromen-4-yl]pyridine is sourced from PubChem (CID 23195791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).