About 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine
2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine (PubChem CID 23195993) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine.
Analyze 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine?
The IUPAC name of 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine (CID 23195993) is 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine.
What is the SMILES notation for 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine?
The canonical SMILES for 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine is C1=CN=C(CC2=NC=CCC2)CC1.
What is the InChIKey of 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine?
The InChIKey is PGLANSGXWYGGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13-11/h3-4,7-8H,1-2,5-6,9H2.
What are the key properties of 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine?
2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine has a molecular weight of 174.25 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydropyridin-2-ylmethyl)-3,4-dihydropyridine is sourced from PubChem (CID 23195993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).