C9H18O2 — CID 23196
2,5-dimethyl-5-propyloxolan-3-ol (PubChem CID 23196) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2,5-dimethyl-5-propyloxolan-3-ol.
| Compound Name | 2,5-dimethyl-5-propyloxolan-3-ol |
|---|---|
| PubChem CID | 23196 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2,5-dimethyl-5-propyloxolan-3-ol |
| SMILES | CCCC1(C)CC(O)C(C)O1 |
| InChI | InChI=1S/C9H18O2/c1-4-5-9(3)6-8(10)7(2)11-9/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | YLSKCDRHHSJFSI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |