About pyridine-2,3-dicarboxylic acid
pyridine-2,3-dicarboxylic acid (PubChem CID 23197009) has the molecular formula C14H10N2O8
and a molecular weight of 334.24 g/mol. Its IUPAC name is pyridine-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | pyridine-2,3-dicarboxylic acid |
| PubChem CID | 23197009 |
| Molecular Formula | C14H10N2O8 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | pyridine-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1cccnc1C(=O)O.O=C(O)c1cccnc1C(=O)O |
| InChI | InChI=1S/2C7H5NO4/c2*9-6(10)4-2-1-3-8-5(4)7(11)12/h2*1-3H,(H,9,10)(H,11,12) |
| InChIKey | PUAGMZJCVWMYIV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyridine-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,3-dicarboxylic acid?
The IUPAC name of pyridine-2,3-dicarboxylic acid (CID 23197009) is pyridine-2,3-dicarboxylic acid.
What is the SMILES notation for pyridine-2,3-dicarboxylic acid?
The canonical SMILES for pyridine-2,3-dicarboxylic acid is O=C(O)c1cccnc1C(=O)O.O=C(O)c1cccnc1C(=O)O.
What is the InChIKey of pyridine-2,3-dicarboxylic acid?
The InChIKey is PUAGMZJCVWMYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5NO4/c2*9-6(10)4-2-1-3-8-5(4)7(11)12/h2*1-3H,(H,9,10)(H,11,12).
What are the key properties of pyridine-2,3-dicarboxylic acid?
pyridine-2,3-dicarboxylic acid has a molecular weight of 334.24 g/mol, XLogP of 0.96, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,3-dicarboxylic acid is sourced from PubChem (CID 23197009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).