About (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole
(2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole (PubChem CID 2319706) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole |
| PubChem CID | 2319706 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole |
| SMILES | C[C@H]1Cc2ccccc2N1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14N2O2S/c1-11-10-12-4-2-3-5-15(12)16(11)20-14-8-6-13(7-9-14)17(18)19/h2-9,11H,10H2,1H3/t11-/m0/s1 |
| InChIKey | SUVPYTDLXDOSFZ-NSHDSACASA-N |
| XLogP | 4.05 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole?
The IUPAC name of (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole (CID 2319706) is (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole.
What is the SMILES notation for (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole?
The canonical SMILES for (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole is C[C@H]1Cc2ccccc2N1Sc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole?
The InChIKey is SUVPYTDLXDOSFZ-NSHDSACASA-N. The full InChI is InChI=1S/C15H14N2O2S/c1-11-10-12-4-2-3-5-15(12)16(11)20-14-8-6-13(7-9-14)17(18)19/h2-9,11H,10H2,1H3/t11-/m0/s1.
What are the key properties of (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole?
(2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole has a molecular weight of 286.36 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-1-(4-nitrophenyl)sulfanyl-2,3-dihydroindole is sourced from PubChem (CID 2319706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).