About 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine
2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine (PubChem CID 2319793) has the molecular formula C13H10BrN3
and a molecular weight of 288.15 g/mol. Its IUPAC name is 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine.
Molecular Properties
| Compound Name | 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine |
| PubChem CID | 2319793 |
| Molecular Formula | C13H10BrN3 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine |
| SMILES | [H]/N=C1\N=C2C=CC(Br)=CN2Cc2ccccc21 |
| InChI | InChI=1S/C13H10BrN3/c14-10-5-6-12-16-13(15)11-4-2-1-3-9(11)7-17(12)8-10/h1-6,8,15H,7H2/b15-13- |
| InChIKey | BYMBVSUQTABCPW-SQFISAMPSA-N |
| XLogP | 3.03 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine?
The IUPAC name of 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine (CID 2319793) is 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine.
What is the SMILES notation for 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine?
The canonical SMILES for 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine is [H]/N=C1\N=C2C=CC(Br)=CN2Cc2ccccc21.
What is the InChIKey of 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine?
The InChIKey is BYMBVSUQTABCPW-SQFISAMPSA-N. The full InChI is InChI=1S/C13H10BrN3/c14-10-5-6-12-16-13(15)11-4-2-1-3-9(11)7-17(12)8-10/h1-6,8,15H,7H2/b15-13-.
What are the key properties of 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine?
2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine has a molecular weight of 288.15 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-imine is sourced from PubChem (CID 2319793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).