C19H31N5 — CID 23198076
2-N,5-N-diethyl-6-piperazin-1-yl-2-N,5-N-bis(prop-2-enyl)pyridine-2,5-diamine (PubChem CID 23198076) has the molecular formula C19H31N5 and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-N,5-N-diethyl-6-piperazin-1-yl-2-N,5-N-bis(prop-2-enyl)pyridine-2,5-diamine.
| Compound Name | 2-N,5-N-diethyl-6-piperazin-1-yl-2-N,5-N-bis(prop-2-enyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 23198076 |
| Molecular Formula | C19H31N5 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 2-N,5-N-diethyl-6-piperazin-1-yl-2-N,5-N-bis(prop-2-enyl)pyridine-2,5-diamine |
| SMILES | C=CCN(CC)c1ccc(N(CC)CC=C)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C19H31N5/c1-5-13-22(7-3)17-9-10-18(23(8-4)14-6-2)21-19(17)24-15-11-20-12-16-24/h5-6,9-10,20H,1-2,7-8,11-16H2,3-4H3 |
| InChIKey | ITQSJOUHUYORQC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|