C12H18FNO2 — CID 23198149
1-amino-1-(3-fluorophenyl)-2,3-dimethylbutane-1,4-diol (PubChem CID 23198149) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-amino-1-(3-fluorophenyl)-2,3-dimethylbutane-1,4-diol.
| Compound Name | 1-amino-1-(3-fluorophenyl)-2,3-dimethylbutane-1,4-diol |
|---|---|
| PubChem CID | 23198149 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-amino-1-(3-fluorophenyl)-2,3-dimethylbutane-1,4-diol |
| SMILES | CC(CO)C(C)C(N)(O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H18FNO2/c1-8(7-15)9(2)12(14,16)10-4-3-5-11(13)6-10/h3-6,8-9,15-16H,7,14H2,1-2H3 |
| InChIKey | WIDQQUUINNSJKE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|