C30H32F3NO4 — CID 23198268
(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-hexylphenyl)-3-pyridinyl]benzoate (PubChem CID 23198268) has the molecular formula C30H32F3NO4 and a molecular weight of 527.58 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-hexylphenyl)-3-pyridinyl]benzoate.
| Compound Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-hexylphenyl)-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 23198268 |
| Molecular Formula | C30H32F3NO4 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-hexylphenyl)-3-pyridinyl]benzoate |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC(C(=O)OCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C30H32F3NO4/c1-3-5-6-7-8-21-9-11-23(12-10-21)26-18-17-25(20-34-26)22-13-15-24(16-14-22)28(35)38-27(30(31,32)33)29(36)37-19-4-2/h9-18,20,27H,3-8,19H2,1-2H3 |
| InChIKey | WXVHOLVCSFOLNN-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|