About 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate
2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 23198623) has the molecular formula C19H29NO5
and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate |
| PubChem CID | 23198623 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CCC1=C(OC(=O)C(C)(C)C)C(=O)C(CCOC(=O)C(C)(C)C)C=N1 |
| InChI | InChI=1S/C19H29NO5/c1-8-13-15(25-17(23)19(5,6)7)14(21)12(11-20-13)9-10-24-16(22)18(2,3)4/h11-12H,8-10H2,1-7H3 |
| InChIKey | YZYAAADALNCRIP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate?
The IUPAC name of 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate (CID 23198623) is 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate?
The canonical SMILES for 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate is CCC1=C(OC(=O)C(C)(C)C)C(=O)C(CCOC(=O)C(C)(C)C)C=N1.
What is the InChIKey of 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate?
The InChIKey is YZYAAADALNCRIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO5/c1-8-13-15(25-17(23)19(5,6)7)14(21)12(11-20-13)9-10-24-16(22)18(2,3)4/h11-12H,8-10H2,1-7H3.
What are the key properties of 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate?
2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate has a molecular weight of 351.44 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,2-dimethylpropanoyloxy)-6-ethyl-4-oxo-3H-pyridin-3-yl]ethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 23198623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).