About 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride
2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride (PubChem CID 23199472) has the molecular formula C13H19Cl2N3O
and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride |
| PubChem CID | 23199472 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride |
| SMILES | CCC(N)C(=O)C1(c2ncc[nH]2)C=CC=CC1.Cl.Cl |
| InChI | InChI=1S/C13H17N3O.2ClH/c1-2-10(14)11(17)13(6-4-3-5-7-13)12-15-8-9-16-12;;/h3-6,8-10H,2,7,14H2,1H3,(H,15,16);2*1H |
| InChIKey | JJFAWDSFPQTQBM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride?
The IUPAC name of 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride (CID 23199472) is 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride.
What is the SMILES notation for 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride?
The canonical SMILES for 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride is CCC(N)C(=O)C1(c2ncc[nH]2)C=CC=CC1.Cl.Cl.
What is the InChIKey of 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride?
The InChIKey is JJFAWDSFPQTQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O.2ClH/c1-2-10(14)11(17)13(6-4-3-5-7-13)12-15-8-9-16-12;;/h3-6,8-10H,2,7,14H2,1H3,(H,15,16);2*1H.
What are the key properties of 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride?
2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride has a molecular weight of 304.22 g/mol, XLogP of 2.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[1-(1H-imidazol-2-yl)cyclohexa-2,4-dien-1-yl]butan-1-one;dihydrochloride is sourced from PubChem (CID 23199472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).