About [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate
[4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate (PubChem CID 23199922) has the molecular formula C11H11NO5
and a molecular weight of 237.21 g/mol. Its IUPAC name is [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate.
Molecular Properties
| Compound Name | [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate |
| PubChem CID | 23199922 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(/C=C(\C)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11NO5/c1-8(12(14)15)7-10-3-5-11(6-4-10)17-16-9(2)13/h3-7H,1-2H3/b8-7+ |
| InChIKey | JWALSAXSEIPTCG-BQYQJAHWSA-N |
| XLogP | 2.18 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate?
The IUPAC name of [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate (CID 23199922) is [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate.
What is the SMILES notation for [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate?
The canonical SMILES for [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate is CC(=O)OOc1ccc(/C=C(\C)[N+](=O)[O-])cc1.
What is the InChIKey of [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate?
The InChIKey is JWALSAXSEIPTCG-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H11NO5/c1-8(12(14)15)7-10-3-5-11(6-4-10)17-16-9(2)13/h3-7H,1-2H3/b8-7+.
What are the key properties of [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate?
[4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate has a molecular weight of 237.21 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-nitroprop-1-enyl]phenyl] ethaneperoxoate is sourced from PubChem (CID 23199922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).