C15H10ClF2NO — CID 2320092
(4S)-4-(4-chlorophenyl)-3,3-difluoro-1-phenylazetidin-2-one (PubChem CID 2320092) has the molecular formula C15H10ClF2NO and a molecular weight of 293.70 g/mol. Its IUPAC name is (4S)-4-(4-chlorophenyl)-3,3-difluoro-1-phenylazetidin-2-one.
| Compound Name | (4S)-4-(4-chlorophenyl)-3,3-difluoro-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 2320092 |
| Molecular Formula | C15H10ClF2NO |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (4S)-4-(4-chlorophenyl)-3,3-difluoro-1-phenylazetidin-2-one |
| SMILES | O=C1N(c2ccccc2)[C@@H](c2ccc(Cl)cc2)C1(F)F |
| InChI | InChI=1S/C15H10ClF2NO/c16-11-8-6-10(7-9-11)13-15(17,18)14(20)19(13)12-4-2-1-3-5-12/h1-9,13H/t13-/m0/s1 |
| InChIKey | CWTUTGNPVJNXJC-ZDUSSCGKSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |