C6HF5S — CID 23200959
2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thione (PubChem CID 23200959) has the molecular formula C6HF5S and a molecular weight of 200.13 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thione.
| Compound Name | 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 23200959 |
| Molecular Formula | C6HF5S |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thione |
| SMILES | FC1=C(F)C(F)=C(F)C(F)C1=S |
| InChI | InChI=1S/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h4H |
| InChIKey | VLPRQBKTSDVJLT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|