C13H7ClF6N2O2S — CID 2320175
2-chloro-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 2320175) has the molecular formula C13H7ClF6N2O2S and a molecular weight of 404.72 g/mol. Its IUPAC name is 2-chloro-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2320175 |
| Molecular Formula | C13H7ClF6N2O2S |
| Molecular Weight | 404.72 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 2-chloro-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(C(O)(C(F)(F)F)C(F)(F)F)s1)c1ccccc1Cl |
| InChI | InChI=1S/C13H7ClF6N2O2S/c14-7-4-2-1-3-6(7)9(23)22-10-21-5-8(25-10)11(24,12(15,16)17)13(18,19)20/h1-5,24H,(H,21,22,23) |
| InChIKey | CEUNKRMFJLNFJN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.72 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |