About 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol
4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol (PubChem CID 23202228) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol |
| PubChem CID | 23202228 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol |
| SMILES | C=C1CC(C)=CC=C1O |
| InChI | InChI=1S/C8H10O/c1-6-3-4-8(9)7(2)5-6/h3-4,9H,2,5H2,1H3 |
| InChIKey | FTZNCFVRSJDKGD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol?
The IUPAC name of 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol (CID 23202228) is 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol?
The canonical SMILES for 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol is C=C1CC(C)=CC=C1O.
What is the InChIKey of 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol?
The InChIKey is FTZNCFVRSJDKGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-6-3-4-8(9)7(2)5-6/h3-4,9H,2,5H2,1H3.
What are the key properties of 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol?
4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol has a molecular weight of 122.17 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-methylidenecyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 23202228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).