C9H8N2OS2 — CID 23202278
2-[(6-methoxy-2-pyridinyl)sulfanyl]-1,3-thiazole (PubChem CID 23202278) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-[(6-methoxy-2-pyridinyl)sulfanyl]-1,3-thiazole.
| Compound Name | 2-[(6-methoxy-2-pyridinyl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 23202278 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-[(6-methoxy-2-pyridinyl)sulfanyl]-1,3-thiazole |
| SMILES | COc1cccc(Sc2nccs2)n1 |
| InChI | InChI=1S/C9H8N2OS2/c1-12-7-3-2-4-8(11-7)14-9-10-5-6-13-9/h2-6H,1H3 |
| InChIKey | PXUNAIDRXQGFII-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|