C13H10F5NO2 — CID 23202472
7-(2,3,4,5,6-pentafluorobenzoyl)azepan-2-one (PubChem CID 23202472) has the molecular formula C13H10F5NO2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 7-(2,3,4,5,6-pentafluorobenzoyl)azepan-2-one.
| Compound Name | 7-(2,3,4,5,6-pentafluorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 23202472 |
| Molecular Formula | C13H10F5NO2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 7-(2,3,4,5,6-pentafluorobenzoyl)azepan-2-one |
| SMILES | O=C1CCCCC(C(=O)c2c(F)c(F)c(F)c(F)c2F)N1 |
| InChI | InChI=1S/C13H10F5NO2/c14-8-7(9(15)11(17)12(18)10(8)16)13(21)5-3-1-2-4-6(20)19-5/h5H,1-4H2,(H,19,20) |
| InChIKey | UXQODANKHWJGRO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|