C16H16F3N3O2 — CID 23202634
5-[6-[3-(trifluoromethyl)phenoxy]pyrazin-2-yl]pentanamide (PubChem CID 23202634) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 5-[6-[3-(trifluoromethyl)phenoxy]pyrazin-2-yl]pentanamide.
| Compound Name | 5-[6-[3-(trifluoromethyl)phenoxy]pyrazin-2-yl]pentanamide |
|---|---|
| PubChem CID | 23202634 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-[6-[3-(trifluoromethyl)phenoxy]pyrazin-2-yl]pentanamide |
| SMILES | NC(=O)CCCCc1cncc(Oc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H16F3N3O2/c17-16(18,19)11-4-3-6-13(8-11)24-15-10-21-9-12(22-15)5-1-2-7-14(20)23/h3-4,6,8-10H,1-2,5,7H2,(H2,20,23) |
| InChIKey | ZNRVGHGXSZKYCN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|