C18H25N3O — CID 23202756
2-(2-imidazol-1-ylethyl)-1-(2-phenoxyethyl)piperidine (PubChem CID 23202756) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-(2-imidazol-1-ylethyl)-1-(2-phenoxyethyl)piperidine.
| Compound Name | 2-(2-imidazol-1-ylethyl)-1-(2-phenoxyethyl)piperidine |
|---|---|
| PubChem CID | 23202756 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-(2-imidazol-1-ylethyl)-1-(2-phenoxyethyl)piperidine |
| SMILES | c1ccc(OCCN2CCCCC2CCn2ccnc2)cc1 |
| InChI | InChI=1S/C18H25N3O/c1-2-7-18(8-3-1)22-15-14-21-11-5-4-6-17(21)9-12-20-13-10-19-16-20/h1-3,7-8,10,13,16-17H,4-6,9,11-12,14-15H2 |
| InChIKey | GZBAWEXXZQVBPM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |