C9H7F6NS — CID 23203066
2-amino-5-(1,1,2,2,3,3-hexafluoropropyl)benzenethiol (PubChem CID 23203066) has the molecular formula C9H7F6NS and a molecular weight of 275.22 g/mol. Its IUPAC name is 2-amino-5-(1,1,2,2,3,3-hexafluoropropyl)benzenethiol.
| Compound Name | 2-amino-5-(1,1,2,2,3,3-hexafluoropropyl)benzenethiol |
|---|---|
| PubChem CID | 23203066 |
| Molecular Formula | C9H7F6NS |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-amino-5-(1,1,2,2,3,3-hexafluoropropyl)benzenethiol |
| SMILES | Nc1ccc(C(F)(F)C(F)(F)C(F)F)cc1S |
| InChI | InChI=1S/C9H7F6NS/c10-7(11)9(14,15)8(12,13)4-1-2-5(16)6(17)3-4/h1-3,7,17H,16H2 |
| InChIKey | OWYMTELIOCMQAE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|